C16H21N3O3 — CID 146625270
2-[[(E)-3-cyanoprop-2-enyl]-[(4-methoxyphenyl)methyl]amino]propylcarbamic acid (PubChem CID 146625270) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[[(E)-3-cyanoprop-2-enyl]-[(4-methoxyphenyl)methyl]amino]propylcarbamic acid.
| Compound Name | 2-[[(E)-3-cyanoprop-2-enyl]-[(4-methoxyphenyl)methyl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 146625270 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-[[(E)-3-cyanoprop-2-enyl]-[(4-methoxyphenyl)methyl]amino]propylcarbamic acid |
| SMILES | COc1ccc(CN(C/C=C/C#N)C(C)CNC(=O)O)cc1 |
| InChI | InChI=1S/C16H21N3O3/c1-13(11-18-16(20)21)19(10-4-3-9-17)12-14-5-7-15(22-2)8-6-14/h3-8,13,18H,10-12H2,1-2H3,(H,20,21)/b4-3+ |
| InChIKey | GPNUBYWDFUWURQ-ONEGZZNKSA-N |
| XLogP | 2.23 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|