C12H16N4O — CID 146625494
13-methyl-11-methylidene-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one (PubChem CID 146625494) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is 13-methyl-11-methylidene-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one.
| Compound Name | 13-methyl-11-methylidene-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one |
|---|---|
| PubChem CID | 146625494 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 13-methyl-11-methylidene-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one |
| SMILES | C=C1CN(C)C(=O)c2c3c(nn2C1)CCNC3 |
| InChI | InChI=1S/C12H16N4O/c1-8-6-15(2)12(17)11-9-5-13-4-3-10(9)14-16(11)7-8/h13H,1,3-7H2,2H3 |
| InChIKey | GHDDGOZQAVTRSZ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|