C11H14F2N4O — CID 146625507
11,11-difluoro-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one (PubChem CID 146625507) has the molecular formula C11H14F2N4O and a molecular weight of 256.26 g/mol. Its IUPAC name is 11,11-difluoro-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one.
| Compound Name | 11,11-difluoro-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one |
|---|---|
| PubChem CID | 146625507 |
| Molecular Formula | C11H14F2N4O |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 11,11-difluoro-13-methyl-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-dien-14-one |
| SMILES | CN1CC(F)(F)Cn2nc3c(c2C1=O)CNCC3 |
| InChI | InChI=1S/C11H14F2N4O/c1-16-5-11(12,13)6-17-9(10(16)18)7-4-14-3-2-8(7)15-17/h14H,2-6H2,1H3 |
| InChIKey | UIMUGUCFVIAANE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |