C20H26F2 — CID 146626064
4-[(2E,4E)-5-(4-ethylcyclohexyl)hexa-2,4-dien-2-yl]-1,2-difluorobenzene (PubChem CID 146626064) has the molecular formula C20H26F2 and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-[(2E,4E)-5-(4-ethylcyclohexyl)hexa-2,4-dien-2-yl]-1,2-difluorobenzene.
| Compound Name | 4-[(2E,4E)-5-(4-ethylcyclohexyl)hexa-2,4-dien-2-yl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 146626064 |
| Molecular Formula | C20H26F2 |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 4-[(2E,4E)-5-(4-ethylcyclohexyl)hexa-2,4-dien-2-yl]-1,2-difluorobenzene |
| SMILES | CCC1CCC(/C(C)=C/C=C(\C)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H26F2/c1-4-16-7-9-17(10-8-16)14(2)5-6-15(3)18-11-12-19(21)20(22)13-18/h5-6,11-13,16-17H,4,7-10H2,1-3H3/b14-5+,15-6+ |
| InChIKey | AEDORYKZQHMZCX-PWSZKDBUSA-N |
| XLogP | 6.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|