About (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone
(3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone (PubChem CID 146626222) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone |
| PubChem CID | 146626222 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone |
| SMILES | CN1CC2CC(C1)N2C(=O)N1CCCC1 |
| InChI | InChI=1S/C11H19N3O/c1-12-7-9-6-10(8-12)14(9)11(15)13-4-2-3-5-13/h9-10H,2-8H2,1H3 |
| InChIKey | QDSLRHXYVFJKAF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone?
The IUPAC name of (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone (CID 146626222) is (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone.
What is the SMILES notation for (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone?
The canonical SMILES for (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone is CN1CC2CC(C1)N2C(=O)N1CCCC1.
What is the InChIKey of (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone?
The InChIKey is QDSLRHXYVFJKAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c1-12-7-9-6-10(8-12)14(9)11(15)13-4-2-3-5-13/h9-10H,2-8H2,1H3.
What are the key properties of (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone?
(3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone has a molecular weight of 209.29 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-3,6-diazabicyclo[3.1.1]heptan-6-yl)-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 146626222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).