C16H17N3O — CID 146626293
4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-methyl-5-(1H-pyrazol-4-yl)pyridin-2-one (PubChem CID 146626293) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-methyl-5-(1H-pyrazol-4-yl)pyridin-2-one.
| Compound Name | 4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-methyl-5-(1H-pyrazol-4-yl)pyridin-2-one |
|---|---|
| PubChem CID | 146626293 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1-methyl-5-(1H-pyrazol-4-yl)pyridin-2-one |
| SMILES | C=C/C=C\C=C(/C)c1cc(=O)n(C)cc1-c1cn[nH]c1 |
| InChI | InChI=1S/C16H17N3O/c1-4-5-6-7-12(2)14-8-16(20)19(3)11-15(14)13-9-17-18-10-13/h4-11H,1H2,2-3H3,(H,17,18)/b6-5-,12-7+ |
| InChIKey | GZESULOOKBBQKS-UNKATYBDSA-N |
| XLogP | 2.92 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|