C11H15N5O2 — CID 146626466
(1S,7R)-N-hydroxy-N',5-dimethyl-9-oxo-4,5,8-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboximidamide (PubChem CID 146626466) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is (1S,7R)-N-hydroxy-N',5-dimethyl-9-oxo-4,5,8-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboximidamide.
| Compound Name | (1S,7R)-N-hydroxy-N',5-dimethyl-9-oxo-4,5,8-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboximidamide |
|---|---|
| PubChem CID | 146626466 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (1S,7R)-N-hydroxy-N',5-dimethyl-9-oxo-4,5,8-triazatricyclo[6.2.1.02,6]undeca-2(6),3-diene-7-carboximidamide |
| SMILES | C/N=C(\NO)[C@H]1c2c(cnn2C)[C@@H]2CC(=O)N1C2 |
| InChI | InChI=1S/C11H15N5O2/c1-12-11(14-18)10-9-7(4-13-15(9)2)6-3-8(17)16(10)5-6/h4,6,10,18H,3,5H2,1-2H3,(H,12,14)/t6-,10-/m1/s1 |
| InChIKey | FYHKHYZXOMAMBX-LHLIQPBNSA-N |
| XLogP | -0.20 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|