C20H19N3O4 — CID 146626687
5-hydroxy-N-[1-(oxolan-3-ylmethoxy)isoquinolin-6-yl]pyridine-2-carboxamide (PubChem CID 146626687) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 5-hydroxy-N-[1-(oxolan-3-ylmethoxy)isoquinolin-6-yl]pyridine-2-carboxamide.
| Compound Name | 5-hydroxy-N-[1-(oxolan-3-ylmethoxy)isoquinolin-6-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146626687 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 5-hydroxy-N-[1-(oxolan-3-ylmethoxy)isoquinolin-6-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(OCC3CCOC3)nccc2c1)c1ccc(O)cn1 |
| InChI | InChI=1S/C20H19N3O4/c24-16-2-4-18(22-10-16)19(25)23-15-1-3-17-14(9-15)5-7-21-20(17)27-12-13-6-8-26-11-13/h1-5,7,9-10,13,24H,6,8,11-12H2,(H,23,25) |
| InChIKey | ZGJQHMDAKYNTTE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |