C20H19N3O5 — CID 146626704
N-[8-hydroxy-1-(oxolan-3-ylmethoxy)isoquinolin-6-yl]-6-oxo-1H-pyridine-2-carboxamide (PubChem CID 146626704) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is N-[8-hydroxy-1-(oxolan-3-ylmethoxy)isoquinolin-6-yl]-6-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-[8-hydroxy-1-(oxolan-3-ylmethoxy)isoquinolin-6-yl]-6-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146626704 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[8-hydroxy-1-(oxolan-3-ylmethoxy)isoquinolin-6-yl]-6-oxo-1H-pyridine-2-carboxamide |
| SMILES | O=C(Nc1cc(O)c2c(OCC3CCOC3)nccc2c1)c1cccc(=O)[nH]1 |
| InChI | InChI=1S/C20H19N3O5/c24-16-9-14(22-19(26)15-2-1-3-17(25)23-15)8-13-4-6-21-20(18(13)16)28-11-12-5-7-27-10-12/h1-4,6,8-9,12,24H,5,7,10-11H2,(H,22,26)(H,23,25) |
| InChIKey | BLLXODMKTIKUPN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |