C7H10N4 — CID 146626816
4-(3,4-dihydropyrazol-2-yl)-1-methylpyrazole (PubChem CID 146626816) has the molecular formula C7H10N4 and a molecular weight of 150.19 g/mol. Its IUPAC name is 4-(3,4-dihydropyrazol-2-yl)-1-methylpyrazole.
| Compound Name | 4-(3,4-dihydropyrazol-2-yl)-1-methylpyrazole |
|---|---|
| PubChem CID | 146626816 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 4-(3,4-dihydropyrazol-2-yl)-1-methylpyrazole |
| SMILES | Cn1cc(N2CCC=N2)cn1 |
| InChI | InChI=1S/C7H10N4/c1-10-6-7(5-9-10)11-4-2-3-8-11/h3,5-6H,2,4H2,1H3 |
| InChIKey | ACNSWXVJXDLGAL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |