C13H4BrF13O2 — CID 146627724
3-bromo-2-hydroxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzaldehyde (PubChem CID 146627724) has the molecular formula C13H4BrF13O2 and a molecular weight of 519.05 g/mol. Its IUPAC name is 3-bromo-2-hydroxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzaldehyde.
| Compound Name | 3-bromo-2-hydroxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzaldehyde |
|---|---|
| PubChem CID | 146627724 |
| Molecular Formula | C13H4BrF13O2 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 517.92 |
| IUPAC Name | 3-bromo-2-hydroxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)benzaldehyde |
| SMILES | O=Cc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(Br)c1O |
| InChI | InChI=1S/C13H4BrF13O2/c14-6-2-5(1-4(3-28)7(6)29)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)27/h1-3,29H |
| InChIKey | YCGNSPVKBIKAET-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|