About (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide
(1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide (PubChem CID 146627730) has the molecular formula C13H15N3O3
and a molecular weight of 261.28 g/mol. Its IUPAC name is (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide.
Molecular Properties
| Compound Name | (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide |
| PubChem CID | 146627730 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide |
| SMILES | N/C(=N\O)c1cccc2c1CC[C@@H]2N1CCOC1=O |
| InChI | InChI=1S/C13H15N3O3/c14-12(15-18)10-3-1-2-9-8(10)4-5-11(9)16-6-7-19-13(16)17/h1-3,11,18H,4-7H2,(H2,14,15)/t11-/m0/s1 |
| InChIKey | CANUBNVFUWPSBU-NSHDSACASA-N |
| XLogP | 1.22 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide?
The IUPAC name of (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide (CID 146627730) is (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide.
What is the SMILES notation for (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide?
The canonical SMILES for (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide is N/C(=N\O)c1cccc2c1CC[C@@H]2N1CCOC1=O.
What is the InChIKey of (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide?
The InChIKey is CANUBNVFUWPSBU-NSHDSACASA-N. The full InChI is InChI=1S/C13H15N3O3/c14-12(15-18)10-3-1-2-9-8(10)4-5-11(9)16-6-7-19-13(16)17/h1-3,11,18H,4-7H2,(H2,14,15)/t11-/m0/s1.
What are the key properties of (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide?
(1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide has a molecular weight of 261.28 g/mol, XLogP of 1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N'-hydroxy-1-(2-oxo-1,3-oxazolidin-3-yl)-2,3-dihydro-1H-indene-4-carboximidamide is sourced from PubChem (CID 146627730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).