About [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate
[(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate (PubChem CID 146627800) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate |
| PubChem CID | 146627800 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate |
| SMILES | CN1CC=C[C@H](OC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C11H19NO2/c1-11(2,3)10(13)14-9-6-5-7-12(4)8-9/h5-6,9H,7-8H2,1-4H3/t9-/m0/s1 |
| InChIKey | UBZJLXOVZLSVSE-VIFPVBQESA-N |
| XLogP | 1.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate?
The IUPAC name of [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate (CID 146627800) is [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate is CN1CC=C[C@H](OC(=O)C(C)(C)C)C1.
What is the InChIKey of [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate?
The InChIKey is UBZJLXOVZLSVSE-VIFPVBQESA-N. The full InChI is InChI=1S/C11H19NO2/c1-11(2,3)10(13)14-9-6-5-7-12(4)8-9/h5-6,9H,7-8H2,1-4H3/t9-/m0/s1.
What are the key properties of [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate?
[(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate has a molecular weight of 197.28 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 146627800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).