About (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol
(3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol (PubChem CID 146627804) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol.
Molecular Properties
| Compound Name | (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol |
| PubChem CID | 146627804 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol |
| SMILES | O[C@H]1C=CCN(C2CCCC2)C1 |
| InChI | InChI=1S/C10H17NO/c12-10-6-3-7-11(8-10)9-4-1-2-5-9/h3,6,9-10,12H,1-2,4-5,7-8H2/t10-/m0/s1 |
| InChIKey | NJVKXBNGMPWROP-JTQLQIEISA-N |
| XLogP | 1.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol?
The IUPAC name of (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol (CID 146627804) is (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol.
What is the SMILES notation for (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol?
The canonical SMILES for (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol is O[C@H]1C=CCN(C2CCCC2)C1.
What is the InChIKey of (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol?
The InChIKey is NJVKXBNGMPWROP-JTQLQIEISA-N. The full InChI is InChI=1S/C10H17NO/c12-10-6-3-7-11(8-10)9-4-1-2-5-9/h3,6,9-10,12H,1-2,4-5,7-8H2/t10-/m0/s1.
What are the key properties of (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol?
(3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol has a molecular weight of 167.25 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-cyclopentyl-3,6-dihydro-2H-pyridin-3-ol is sourced from PubChem (CID 146627804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).