C25H28N4O2 — CID 146627929
[1,6-bis(4-propan-2-yloxyphenyl)benzotriazol-5-yl]methanamine (PubChem CID 146627929) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is [1,6-bis(4-propan-2-yloxyphenyl)benzotriazol-5-yl]methanamine.
| Compound Name | [1,6-bis(4-propan-2-yloxyphenyl)benzotriazol-5-yl]methanamine |
|---|---|
| PubChem CID | 146627929 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [1,6-bis(4-propan-2-yloxyphenyl)benzotriazol-5-yl]methanamine |
| SMILES | CC(C)Oc1ccc(-c2cc3c(cc2CN)nnn3-c2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H28N4O2/c1-16(2)30-21-9-5-18(6-10-21)23-14-25-24(13-19(23)15-26)27-28-29(25)20-7-11-22(12-8-20)31-17(3)4/h5-14,16-17H,15,26H2,1-4H3 |
| InChIKey | INKPEUODFNQWRE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |