C27H41NO — CID 146628332
(3R,5R,8R,9R,10S,13S,14S,17S)-17-[(1R)-1-anilinoethyl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 146628332) has the molecular formula C27H41NO and a molecular weight of 395.63 g/mol. Its IUPAC name is (3R,5R,8R,9R,10S,13S,14S,17S)-17-[(1R)-1-anilinoethyl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5R,8R,9R,10S,13S,14S,17S)-17-[(1R)-1-anilinoethyl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 146628332 |
| Molecular Formula | C27H41NO |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.32 |
| IUPAC Name | (3R,5R,8R,9R,10S,13S,14S,17S)-17-[(1R)-1-anilinoethyl]-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@H](Nc1ccccc1)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@](C)(O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H41NO/c1-18(28-20-7-5-4-6-8-20)24-11-12-25-23-10-9-19-17-26(2,29)15-13-21(19)22(23)14-16-27(24,25)3/h4-8,18-19,21-25,28-29H,9-17H2,1-3H3/t18-,19-,21+,22-,23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | LZDKRNOIMUYXAO-KFSIEFEKSA-N |
| XLogP | 6.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |