C18H19ClN2O3S — CID 146628413
2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-ethylphenyl)benzamide (PubChem CID 146628413) has the molecular formula C18H19ClN2O3S and a molecular weight of 378.88 g/mol. Its IUPAC name is 2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-ethylphenyl)benzamide.
| Compound Name | 2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-ethylphenyl)benzamide |
|---|---|
| PubChem CID | 146628413 |
| Molecular Formula | C18H19ClN2O3S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-chloro-5-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-ethylphenyl)benzamide |
| SMILES | CCc1cccc(NC(=O)c2cc(N3CCCS3(=O)=O)ccc2Cl)c1 |
| InChI | InChI=1S/C18H19ClN2O3S/c1-2-13-5-3-6-14(11-13)20-18(22)16-12-15(7-8-17(16)19)21-9-4-10-25(21,23)24/h3,5-8,11-12H,2,4,9-10H2,1H3,(H,20,22) |
| InChIKey | NGLGMWBZKYKCAK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |