About (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol
(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol (PubChem CID 146628666) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol.
Molecular Properties
| Compound Name | (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol |
| PubChem CID | 146628666 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol |
| SMILES | CN1CC=C[C@H](O)C1 |
| InChI | InChI=1S/C6H11NO/c1-7-4-2-3-6(8)5-7/h2-3,6,8H,4-5H2,1H3/t6-/m0/s1 |
| InChIKey | GLDHZKQYHDFALD-LURJTMIESA-N |
| XLogP | -0.15 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol?
The IUPAC name of (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol (CID 146628666) is (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol.
What is the SMILES notation for (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol?
The canonical SMILES for (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol is CN1CC=C[C@H](O)C1.
What is the InChIKey of (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol?
The InChIKey is GLDHZKQYHDFALD-LURJTMIESA-N. The full InChI is InChI=1S/C6H11NO/c1-7-4-2-3-6(8)5-7/h2-3,6,8H,4-5H2,1H3/t6-/m0/s1.
What are the key properties of (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol?
(3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol has a molecular weight of 113.16 g/mol, XLogP of -0.15, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-methyl-3,6-dihydro-2H-pyridin-3-ol is sourced from PubChem (CID 146628666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).