About 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol
1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol (PubChem CID 146628687) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol.
Molecular Properties
| Compound Name | 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol |
| PubChem CID | 146628687 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol |
| SMILES | OC1C=CCN(Cc2ccoc2)C1 |
| InChI | InChI=1S/C10H13NO2/c12-10-2-1-4-11(7-10)6-9-3-5-13-8-9/h1-3,5,8,10,12H,4,6-7H2 |
| InChIKey | ONRHFWABKSVFOH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol?
The IUPAC name of 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol (CID 146628687) is 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol.
What is the SMILES notation for 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol?
The canonical SMILES for 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol is OC1C=CCN(Cc2ccoc2)C1.
What is the InChIKey of 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol?
The InChIKey is ONRHFWABKSVFOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c12-10-2-1-4-11(7-10)6-9-3-5-13-8-9/h1-3,5,8,10,12H,4,6-7H2.
What are the key properties of 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol?
1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol has a molecular weight of 179.22 g/mol, XLogP of 1.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-3-ylmethyl)-3,6-dihydro-2H-pyridin-3-ol is sourced from PubChem (CID 146628687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).