About (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate
(1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate (PubChem CID 146628721) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate |
| PubChem CID | 146628721 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate |
| SMILES | CC(C)N1CC=CC(OC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C13H23NO2/c1-10(2)14-8-6-7-11(9-14)16-12(15)13(3,4)5/h6-7,10-11H,8-9H2,1-5H3 |
| InChIKey | KARMSYXUYHSWIX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate?
The IUPAC name of (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate (CID 146628721) is (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate.
What is the SMILES notation for (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate?
The canonical SMILES for (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate is CC(C)N1CC=CC(OC(=O)C(C)(C)C)C1.
What is the InChIKey of (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate?
The InChIKey is KARMSYXUYHSWIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-10(2)14-8-6-7-11(9-14)16-12(15)13(3,4)5/h6-7,10-11H,8-9H2,1-5H3.
What are the key properties of (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate?
(1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate has a molecular weight of 225.33 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propan-2-yl-3,6-dihydro-2H-pyridin-3-yl) 2,2-dimethylpropanoate is sourced from PubChem (CID 146628721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).