C31H52NO10+ — CID 146629259
dimethyl-prop-2-ynyl-[4-[(3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-(butanoyloxymethyl)oxan-2-yl]oxybutyl]azanium (PubChem CID 146629259) has the molecular formula C31H52NO10+ and a molecular weight of 598.75 g/mol. Its IUPAC name is dimethyl-prop-2-ynyl-[4-[(3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-(butanoyloxymethyl)oxan-2-yl]oxybutyl]azanium.
| Compound Name | dimethyl-prop-2-ynyl-[4-[(3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-(butanoyloxymethyl)oxan-2-yl]oxybutyl]azanium |
|---|---|
| PubChem CID | 146629259 |
| Molecular Formula | C31H52NO10+ |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.36 |
| IUPAC Name | dimethyl-prop-2-ynyl-[4-[(3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-(butanoyloxymethyl)oxan-2-yl]oxybutyl]azanium |
| SMILES | C#CC[N+](C)(C)CCCCOC1O[C@H](COC(=O)CCC)[C@@H](OC(=O)CCC)[C@H](OC(=O)CCC)[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C31H52NO10/c1-8-15-24(33)38-22-23-28(40-25(34)16-9-2)29(41-26(35)17-10-3)30(42-27(36)18-11-4)31(39-23)37-21-14-13-20-32(6,7)19-12-5/h5,23,28-31H,8-11,13-22H2,1-4,6-7H3/q+1/t23-,28-,29+,30-,31?/m1/s1 |
| InChIKey | DJBJIDWOTDPHGU-OWPSYIBRSA-N |
| XLogP | 3.70 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|