C20H30NO9+ — CID 146629291
dimethyl-[4-oxo-4-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybutyl]-prop-2-ynylazanium (PubChem CID 146629291) has the molecular formula C20H30NO9+ and a molecular weight of 428.46 g/mol. Its IUPAC name is dimethyl-[4-oxo-4-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybutyl]-prop-2-ynylazanium.
| Compound Name | dimethyl-[4-oxo-4-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybutyl]-prop-2-ynylazanium |
|---|---|
| PubChem CID | 146629291 |
| Molecular Formula | C20H30NO9+ |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | dimethyl-[4-oxo-4-[(3R,4S,5R)-3,4,5-triacetyloxyoxan-2-yl]oxybutyl]-prop-2-ynylazanium |
| SMILES | C#CC[N+](C)(C)CCCC(=O)OC1OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H30NO9/c1-7-10-21(5,6)11-8-9-17(25)30-20-19(29-15(4)24)18(28-14(3)23)16(12-26-20)27-13(2)22/h1,16,18-20H,8-12H2,2-6H3/q+1/t16-,18+,19-,20?/m1/s1 |
| InChIKey | YIXWLWNLQRCLJW-BVXPGSOGSA-N |
| XLogP | 0.17 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|