C28H45NO10 — CID 146629292
[(2R,3R,4S,5R)-3,4,5-tri(butanoyloxy)-6-[2-[methyl(prop-2-ynyl)amino]ethoxy]oxan-2-yl]methyl butanoate (PubChem CID 146629292) has the molecular formula C28H45NO10 and a molecular weight of 555.67 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-tri(butanoyloxy)-6-[2-[methyl(prop-2-ynyl)amino]ethoxy]oxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-tri(butanoyloxy)-6-[2-[methyl(prop-2-ynyl)amino]ethoxy]oxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 146629292 |
| Molecular Formula | C28H45NO10 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-tri(butanoyloxy)-6-[2-[methyl(prop-2-ynyl)amino]ethoxy]oxan-2-yl]methyl butanoate |
| SMILES | C#CCN(C)CCOC1O[C@H](COC(=O)CCC)[C@@H](OC(=O)CCC)[C@H](OC(=O)CCC)[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C28H45NO10/c1-7-12-21(30)35-19-20-25(37-22(31)13-8-2)26(38-23(32)14-9-3)27(39-24(33)15-10-4)28(36-20)34-18-17-29(6)16-11-5/h5,20,25-28H,7-10,12-19H2,1-4,6H3/t20-,25-,26+,27-,28?/m1/s1 |
| InChIKey | XHALBWSLNYJIBE-IVOTZNQUSA-N |
| XLogP | 2.77 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|