C23H36BrNO10 — CID 146629299
dimethyl-prop-2-ynyl-[4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybutyl]azanium bromide (PubChem CID 146629299) has the molecular formula C23H36BrNO10 and a molecular weight of 566.44 g/mol. Its IUPAC name is dimethyl-prop-2-ynyl-[4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybutyl]azanium bromide.
| Compound Name | dimethyl-prop-2-ynyl-[4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybutyl]azanium bromide |
|---|---|
| PubChem CID | 146629299 |
| Molecular Formula | C23H36BrNO10 |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | dimethyl-prop-2-ynyl-[4-[(3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxybutyl]azanium bromide |
| SMILES | C#CC[N+](C)(C)CCCCOC1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O.[Br-] |
| InChI | InChI=1S/C23H36NO10.BrH/c1-8-11-24(6,7)12-9-10-13-29-23-22(33-18(5)28)21(32-17(4)27)20(31-16(3)26)19(34-23)14-30-15(2)25;/h1,19-23H,9-14H2,2-7H3;1H/q+1;/p-1/t19-,20-,21+,22-,23?;/m1./s1 |
| InChIKey | LFJXVBFSIYOSAM-UVFUZWBFSA-M |
| XLogP | -2.42 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|