C24H38ClNO9 — CID 146629309
dimethyl-[2-oxo-2-[(3R,4S,5R)-3,4,5-tri(butanoyloxy)oxan-2-yl]oxyethyl]-prop-2-ynylazanium chloride (PubChem CID 146629309) has the molecular formula C24H38ClNO9 and a molecular weight of 520.02 g/mol. Its IUPAC name is dimethyl-[2-oxo-2-[(3R,4S,5R)-3,4,5-tri(butanoyloxy)oxan-2-yl]oxyethyl]-prop-2-ynylazanium chloride.
| Compound Name | dimethyl-[2-oxo-2-[(3R,4S,5R)-3,4,5-tri(butanoyloxy)oxan-2-yl]oxyethyl]-prop-2-ynylazanium chloride |
|---|---|
| PubChem CID | 146629309 |
| Molecular Formula | C24H38ClNO9 |
| Molecular Weight | 520.02 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | dimethyl-[2-oxo-2-[(3R,4S,5R)-3,4,5-tri(butanoyloxy)oxan-2-yl]oxyethyl]-prop-2-ynylazanium chloride |
| SMILES | C#CC[N+](C)(C)CC(=O)OC1OC[C@@H](OC(=O)CCC)[C@H](OC(=O)CCC)[C@H]1OC(=O)CCC.[Cl-] |
| InChI | InChI=1S/C24H38NO9.ClH/c1-7-11-18(26)31-17-16-30-24(34-21(29)15-25(5,6)14-10-4)23(33-20(28)13-9-3)22(17)32-19(27)12-8-2;/h4,17,22-24H,7-9,11-16H2,1-3,5-6H3;1H/q+1;/p-1/t17-,22+,23-,24?;/m1./s1 |
| InChIKey | QPEFSNABJYPUSK-JCHJQSKGSA-M |
| XLogP | -1.26 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.02 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|