About 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene
1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene (PubChem CID 14662933) has the molecular formula C21H24O2SSe
and a molecular weight of 419.45 g/mol. Its IUPAC name is 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene.
Molecular Properties
| Compound Name | 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene |
| PubChem CID | 14662933 |
| Molecular Formula | C21H24O2SSe |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)/C=C(\C=C\CC(C)C)[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24O2SSe/c1-17(2)8-7-11-21(25-20-9-5-4-6-10-20)16-24(22,23)19-14-12-18(3)13-15-19/h4-7,9-17H,8H2,1-3H3/b11-7+,21-16+ |
| InChIKey | RRAWIPRCJUKYPM-HIMKIRJDSA-N |
| XLogP | 4.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene?
The IUPAC name of 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene (CID 14662933) is 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene.
What is the SMILES notation for 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene?
The canonical SMILES for 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene is Cc1ccc(S(=O)(=O)/C=C(\C=C\CC(C)C)[Se]c2ccccc2)cc1.
What is the InChIKey of 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene?
The InChIKey is RRAWIPRCJUKYPM-HIMKIRJDSA-N. The full InChI is InChI=1S/C21H24O2SSe/c1-17(2)8-7-11-21(25-20-9-5-4-6-10-20)16-24(22,23)19-14-12-18(3)13-15-19/h4-7,9-17H,8H2,1-3H3/b11-7+,21-16+.
What are the key properties of 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene?
1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene has a molecular weight of 419.45 g/mol, XLogP of 4.24, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(1E,3E)-6-methyl-2-phenylselanylhepta-1,3-dienyl]sulfonylbenzene is sourced from PubChem (CID 14662933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).