C27H29BrN4O4 — CID 146630423
5-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-1-[2-oxo-2-[(1-prop-2-enoylazetidin-3-yl)amino]ethyl]indole-3-carboxamide (PubChem CID 146630423) has the molecular formula C27H29BrN4O4 and a molecular weight of 553.46 g/mol. Its IUPAC name is 5-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-1-[2-oxo-2-[(1-prop-2-enoylazetidin-3-yl)amino]ethyl]indole-3-carboxamide.
| Compound Name | 5-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-1-[2-oxo-2-[(1-prop-2-enoylazetidin-3-yl)amino]ethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 146630423 |
| Molecular Formula | C27H29BrN4O4 |
| Molecular Weight | 553.46 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | 5-bromo-N-[2-(2,6-dimethylphenoxy)ethyl]-1-[2-oxo-2-[(1-prop-2-enoylazetidin-3-yl)amino]ethyl]indole-3-carboxamide |
| SMILES | C=CC(=O)N1CC(NC(=O)Cn2cc(C(=O)NCCOc3c(C)cccc3C)c3cc(Br)ccc32)C1 |
| InChI | InChI=1S/C27H29BrN4O4/c1-4-25(34)32-13-20(14-32)30-24(33)16-31-15-22(21-12-19(28)8-9-23(21)31)27(35)29-10-11-36-26-17(2)6-5-7-18(26)3/h4-9,12,15,20H,1,10-11,13-14,16H2,2-3H3,(H,29,35)(H,30,33) |
| InChIKey | SGQSERVAWXGVQF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|