About 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide
2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide (PubChem CID 146630707) has the molecular formula C22H18BrF2N3O2
and a molecular weight of 474.31 g/mol. Its IUPAC name is 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide |
| PubChem CID | 146630707 |
| Molecular Formula | C22H18BrF2N3O2 |
| Molecular Weight | 474.31 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide |
| SMILES | C=CC(=O)N1CC(NC(=O)Cn2cc(-c3ccc(F)cc3F)c3cc(Br)ccc32)C1 |
| InChI | InChI=1S/C22H18BrF2N3O2/c1-2-22(30)28-9-15(10-28)26-21(29)12-27-11-18(16-5-4-14(24)8-19(16)25)17-7-13(23)3-6-20(17)27/h2-8,11,15H,1,9-10,12H2,(H,26,29) |
| InChIKey | VVLNIBQIUNJLOF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide?
The IUPAC name of 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide (CID 146630707) is 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide.
What is the SMILES notation for 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide?
The canonical SMILES for 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide is C=CC(=O)N1CC(NC(=O)Cn2cc(-c3ccc(F)cc3F)c3cc(Br)ccc32)C1.
What is the InChIKey of 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide?
The InChIKey is VVLNIBQIUNJLOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18BrF2N3O2/c1-2-22(30)28-9-15(10-28)26-21(29)12-27-11-18(16-5-4-14(24)8-19(16)25)17-7-13(23)3-6-20(17)27/h2-8,11,15H,1,9-10,12H2,(H,26,29).
What are the key properties of 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide?
2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide has a molecular weight of 474.31 g/mol, XLogP of 3.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-bromo-3-(2,4-difluorophenyl)indol-1-yl]-N-(1-prop-2-enoylazetidin-3-yl)acetamide is sourced from PubChem (CID 146630707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).