C29H19N3O3 — CID 146630792
benzyl 4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine-2-carboxylate (PubChem CID 146630792) has the molecular formula C29H19N3O3 and a molecular weight of 457.49 g/mol. Its IUPAC name is benzyl 4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine-2-carboxylate.
| Compound Name | benzyl 4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine-2-carboxylate |
|---|---|
| PubChem CID | 146630792 |
| Molecular Formula | C29H19N3O3 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | benzyl 4-dibenzofuran-3-yl-6-phenyl-1,3,5-triazine-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1nc(-c2ccccc2)nc(-c2ccc3c(c2)oc2ccccc23)n1 |
| InChI | InChI=1S/C29H19N3O3/c33-29(34-18-19-9-3-1-4-10-19)28-31-26(20-11-5-2-6-12-20)30-27(32-28)21-15-16-23-22-13-7-8-14-24(22)35-25(23)17-21/h1-17H,18H2 |
| InChIKey | WAKNAUUMHPPHTR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |