C18H26FNO — CID 146631245
(5S,6R,8R,9S,10R,13S,14S)-6-fluoro-17-imino-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 146631245) has the molecular formula C18H26FNO and a molecular weight of 291.41 g/mol. Its IUPAC name is (5S,6R,8R,9S,10R,13S,14S)-6-fluoro-17-imino-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (5S,6R,8R,9S,10R,13S,14S)-6-fluoro-17-imino-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 146631245 |
| Molecular Formula | C18H26FNO |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (5S,6R,8R,9S,10R,13S,14S)-6-fluoro-17-imino-13-methyl-1,2,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | [H]/N=C1\CC[C@H]2[C@@H]3C[C@@H](F)[C@H]4CC(=O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C18H26FNO/c1-18-7-6-12-11-3-2-10(21)8-14(11)16(19)9-13(12)15(18)4-5-17(18)20/h11-16,20H,2-9H2,1H3/b20-17+/t11-,12-,13-,14+,15+,16-,18+/m1/s1 |
| InChIKey | JZOPBYUMKYNBSY-GUISAALASA-N |
| XLogP | 4.18 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|