C70H53F2N5 — CID 146631538
3,5-bis(3,6-dimethylcarbazol-9-yl)-2,6-bis(3-fluorocarbazol-9-yl)-4-(2,3,4,5,6-pentamethylphenyl)benzonitrile (PubChem CID 146631538) has the molecular formula C70H53F2N5 and a molecular weight of 1002.23 g/mol. Its IUPAC name is 3,5-bis(3,6-dimethylcarbazol-9-yl)-2,6-bis(3-fluorocarbazol-9-yl)-4-(2,3,4,5,6-pentamethylphenyl)benzonitrile.
| Compound Name | 3,5-bis(3,6-dimethylcarbazol-9-yl)-2,6-bis(3-fluorocarbazol-9-yl)-4-(2,3,4,5,6-pentamethylphenyl)benzonitrile |
|---|---|
| PubChem CID | 146631538 |
| Molecular Formula | C70H53F2N5 |
| Molecular Weight | 1002.23 g/mol |
| Exact Mass | 1001.43 |
| IUPAC Name | 3,5-bis(3,6-dimethylcarbazol-9-yl)-2,6-bis(3-fluorocarbazol-9-yl)-4-(2,3,4,5,6-pentamethylphenyl)benzonitrile |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1c(-c2c(C)c(C)c(C)c(C)c2C)c(-n2c3ccc(C)cc3c3cc(C)ccc32)c(-n2c3ccccc3c3cc(F)ccc32)c(C#N)c1-n1c2ccccc2c2cc(F)ccc21 |
| InChI | InChI=1S/C70H53F2N5/c1-37-18-24-59-50(30-37)51-31-38(2)19-25-60(51)76(59)69-66(65-44(8)42(6)41(5)43(7)45(65)9)70(77-61-26-20-39(3)32-52(61)53-33-40(4)21-27-62(53)77)68(75-58-17-13-11-15-49(58)55-35-47(72)23-29-64(55)75)56(36-73)67(69)74-57-16-12-10-14-48(57)54-34-46(71)22-28-63(54)74/h10-35H,1-9H3 |
| InChIKey | OYFQCIFEJPOGRM-UHFFFAOYSA-N |
| XLogP | 18.67 |
| TPSA | 43.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.23 |
| LogP ≤ 5 | 18.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |