C16H27NO2 — CID 146632697
N-cyclohexyl-2-[(2E,4Z)-octa-2,4-dien-3-yl]oxyacetamide (PubChem CID 146632697) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2E,4Z)-octa-2,4-dien-3-yl]oxyacetamide.
| Compound Name | N-cyclohexyl-2-[(2E,4Z)-octa-2,4-dien-3-yl]oxyacetamide |
|---|---|
| PubChem CID | 146632697 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-cyclohexyl-2-[(2E,4Z)-octa-2,4-dien-3-yl]oxyacetamide |
| SMILES | C/C=C(\C=C/CCC)OCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H27NO2/c1-3-5-7-12-15(4-2)19-13-16(18)17-14-10-8-6-9-11-14/h4,7,12,14H,3,5-6,8-11,13H2,1-2H3,(H,17,18)/b12-7-,15-4+ |
| InChIKey | ZGMUVYDEERUDKY-OUZDOPHASA-N |
| XLogP | 3.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|