C42H31N3 — CID 146632880
4-[3-(9,9-dimethylfluoren-3-yl)phenyl]-2-(3-phenylphenyl)-6-pyridin-3-ylpyrimidine (PubChem CID 146632880) has the molecular formula C42H31N3 and a molecular weight of 577.73 g/mol. Its IUPAC name is 4-[3-(9,9-dimethylfluoren-3-yl)phenyl]-2-(3-phenylphenyl)-6-pyridin-3-ylpyrimidine.
| Compound Name | 4-[3-(9,9-dimethylfluoren-3-yl)phenyl]-2-(3-phenylphenyl)-6-pyridin-3-ylpyrimidine |
|---|---|
| PubChem CID | 146632880 |
| Molecular Formula | C42H31N3 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | 4-[3-(9,9-dimethylfluoren-3-yl)phenyl]-2-(3-phenylphenyl)-6-pyridin-3-ylpyrimidine |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3cccc(-c4cc(-c5cccnc5)nc(-c5cccc(-c6ccccc6)c5)n4)c3)ccc21 |
| InChI | InChI=1S/C42H31N3/c1-42(2)37-19-7-6-18-35(37)36-25-31(20-21-38(36)42)30-14-8-15-32(23-30)39-26-40(34-17-10-22-43-27-34)45-41(44-39)33-16-9-13-29(24-33)28-11-4-3-5-12-28/h3-27H,1-2H3 |
| InChIKey | SBZSOWMJLRNQFD-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |