About 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile
10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile (PubChem CID 146632948) has the molecular formula C29H16N3O2P
and a molecular weight of 469.44 g/mol. Its IUPAC name is 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile.
Molecular Properties
| Compound Name | 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile |
| PubChem CID | 146632948 |
| Molecular Formula | C29H16N3O2P |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile |
| SMILES | N#Cc1ccc2c(c1)P(=O)(c1ccc(-c3nccc4ccccc34)cc1)c1cc(C#N)ccc1O2 |
| InChI | InChI=1S/C29H16N3O2P/c30-17-19-5-11-25-27(15-19)35(33,28-16-20(18-31)6-12-26(28)34-25)23-9-7-22(8-10-23)29-24-4-2-1-3-21(24)13-14-32-29/h1-16H |
| InChIKey | HOHYVWBPJNLLIM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile?
The IUPAC name of 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile (CID 146632948) is 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile.
What is the SMILES notation for 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile?
The canonical SMILES for 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile is N#Cc1ccc2c(c1)P(=O)(c1ccc(-c3nccc4ccccc34)cc1)c1cc(C#N)ccc1O2.
What is the InChIKey of 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile?
The InChIKey is HOHYVWBPJNLLIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H16N3O2P/c30-17-19-5-11-25-27(15-19)35(33,28-16-20(18-31)6-12-26(28)34-25)23-9-7-22(8-10-23)29-24-4-2-1-3-21(24)13-14-32-29/h1-16H.
What are the key properties of 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile?
10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile has a molecular weight of 469.44 g/mol, XLogP of 5.39, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(4-isoquinolin-1-ylphenyl)-10-oxophenoxaphosphinine-2,8-dicarbonitrile is sourced from PubChem (CID 146632948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).