C51H32N4 — CID 146633338
2-phenyl-4-(6-phenyl-3-pyridinyl)-6-[4-(9,9'-spirobi[fluorene]-2-yl)phenyl]-1,3,5-triazine (PubChem CID 146633338) has the molecular formula C51H32N4 and a molecular weight of 700.85 g/mol. Its IUPAC name is 2-phenyl-4-(6-phenyl-3-pyridinyl)-6-[4-(9,9'-spirobi[fluorene]-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(6-phenyl-3-pyridinyl)-6-[4-(9,9'-spirobi[fluorene]-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 146633338 |
| Molecular Formula | C51H32N4 |
| Molecular Weight | 700.85 g/mol |
| Exact Mass | 700.26 |
| IUPAC Name | 2-phenyl-4-(6-phenyl-3-pyridinyl)-6-[4-(9,9'-spirobi[fluorene]-2-yl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccc6c(c5)C5(c7ccccc7-c7ccccc75)c5ccccc5-6)cc4)n3)cn2)cc1 |
| InChI | InChI=1S/C51H32N4/c1-3-13-34(14-4-1)47-30-28-38(32-52-47)50-54-48(35-15-5-2-6-16-35)53-49(55-50)36-25-23-33(24-26-36)37-27-29-42-41-19-9-12-22-45(41)51(46(42)31-37)43-20-10-7-17-39(43)40-18-8-11-21-44(40)51/h1-32H |
| InChIKey | CTZVYHTUAUEVCY-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.85 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |