C18H27F2NO3 — CID 146633424
tert-butyl (3S,4R)-4-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-3-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 146633424) has the molecular formula C18H27F2NO3 and a molecular weight of 343.41 g/mol. Its IUPAC name is tert-butyl (3S,4R)-4-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-3-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-4-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-3-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146633424 |
| Molecular Formula | C18H27F2NO3 |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | tert-butyl (3S,4R)-4-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]-3-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | C=C(/C=C\C(F)=C(/C)F)[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1CO |
| InChI | InChI=1S/C18H27F2NO3/c1-12(6-7-16(20)13(2)19)15-8-9-21(10-14(15)11-22)17(23)24-18(3,4)5/h6-7,14-15,22H,1,8-11H2,2-5H3/b7-6-,16-13-/t14-,15-/m0/s1 |
| InChIKey | BUEJVEOGYKPGDF-VVBCAFAASA-N |
| XLogP | 4.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|