C25H26FN5O5 — CID 146633610
1-[(5R)-3-[2-[(2R,5R)-2-(6-fluoro-3-pyridinyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea (PubChem CID 146633610) has the molecular formula C25H26FN5O5 and a molecular weight of 495.51 g/mol. Its IUPAC name is 1-[(5R)-3-[2-[(2R,5R)-2-(6-fluoro-3-pyridinyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea.
| Compound Name | 1-[(5R)-3-[2-[(2R,5R)-2-(6-fluoro-3-pyridinyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea |
|---|---|
| PubChem CID | 146633610 |
| Molecular Formula | C25H26FN5O5 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 1-[(5R)-3-[2-[(2R,5R)-2-(6-fluoro-3-pyridinyl)-5-methylpyrrolidin-1-yl]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc2c(c1)CC[C@@]21OC(=O)N(CC(=O)N2[C@H](C)CC[C@@H]2c2ccc(F)nc2)C1=O |
| InChI | InChI=1S/C25H26FN5O5/c1-14-3-7-19(16-4-8-20(26)28-12-16)31(14)21(32)13-30-22(33)25(36-24(30)35)10-9-15-11-17(5-6-18(15)25)29-23(34)27-2/h4-6,8,11-12,14,19H,3,7,9-10,13H2,1-2H3,(H2,27,29,34)/t14-,19-,25-/m1/s1 |
| InChIKey | LTYUNPSXFYVRET-LNMSCABWSA-N |
| XLogP | 2.84 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|