About 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole
5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole (PubChem CID 146633765) has the molecular formula C11H11BrFN
and a molecular weight of 256.12 g/mol. Its IUPAC name is 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole |
| PubChem CID | 146633765 |
| Molecular Formula | C11H11BrFN |
| Molecular Weight | 256.12 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole |
| SMILES | CC1CCC(c2ccc(F)cc2Br)=N1 |
| InChI | InChI=1S/C11H11BrFN/c1-7-2-5-11(14-7)9-4-3-8(13)6-10(9)12/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | AHQVQIOFPXIDKD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole?
The IUPAC name of 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole (CID 146633765) is 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole is CC1CCC(c2ccc(F)cc2Br)=N1.
What is the InChIKey of 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole?
The InChIKey is AHQVQIOFPXIDKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrFN/c1-7-2-5-11(14-7)9-4-3-8(13)6-10(9)12/h3-4,6-7H,2,5H2,1H3.
What are the key properties of 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole?
5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole has a molecular weight of 256.12 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromo-4-fluorophenyl)-2-methyl-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 146633765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).