C17H26F2N2O2 — CID 146633811
tert-butyl (3S,4S)-3-amino-4-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]piperidine-1-carboxylate (PubChem CID 146633811) has the molecular formula C17H26F2N2O2 and a molecular weight of 328.40 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-amino-4-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-amino-4-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146633811 |
| Molecular Formula | C17H26F2N2O2 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | tert-butyl (3S,4S)-3-amino-4-[(3Z,5Z)-5,6-difluorohepta-1,3,5-trien-2-yl]piperidine-1-carboxylate |
| SMILES | C=C(/C=C\C(F)=C(/C)F)[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1N |
| InChI | InChI=1S/C17H26F2N2O2/c1-11(6-7-14(19)12(2)18)13-8-9-21(10-15(13)20)16(22)23-17(3,4)5/h6-7,13,15H,1,8-10,20H2,2-5H3/b7-6-,14-12-/t13-,15+/m0/s1 |
| InChIKey | MJMRQIRGLZJZGZ-RTNNJOMHSA-N |
| XLogP | 3.85 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|