C13H19F3S — CID 146633819
(3E,5Z)-5-ethylsulfanyl-6,7-dimethyl-3-(trifluoromethyl)octa-1,3,5-triene (PubChem CID 146633819) has the molecular formula C13H19F3S and a molecular weight of 264.36 g/mol. Its IUPAC name is (3E,5Z)-5-ethylsulfanyl-6,7-dimethyl-3-(trifluoromethyl)octa-1,3,5-triene.
| Compound Name | (3E,5Z)-5-ethylsulfanyl-6,7-dimethyl-3-(trifluoromethyl)octa-1,3,5-triene |
|---|---|
| PubChem CID | 146633819 |
| Molecular Formula | C13H19F3S |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (3E,5Z)-5-ethylsulfanyl-6,7-dimethyl-3-(trifluoromethyl)octa-1,3,5-triene |
| SMILES | C=C/C(=C\C(SCC)=C(/C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H19F3S/c1-6-11(13(14,15)16)8-12(17-7-2)10(5)9(3)4/h6,8-9H,1,7H2,2-5H3/b11-8+,12-10- |
| InChIKey | PTBGFLUKARVVAJ-GWPDKMJPSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|