C36H35N7O4 — CID 146633849
ethyl 4-[2-[(1S)-1-[[9-(oxan-2-yl)purin-6-yl]amino]propyl]-4-oxo-3-phenylquinazolin-5-yl]benzoate (PubChem CID 146633849) has the molecular formula C36H35N7O4 and a molecular weight of 629.72 g/mol. Its IUPAC name is ethyl 4-[2-[(1S)-1-[[9-(oxan-2-yl)purin-6-yl]amino]propyl]-4-oxo-3-phenylquinazolin-5-yl]benzoate.
| Compound Name | ethyl 4-[2-[(1S)-1-[[9-(oxan-2-yl)purin-6-yl]amino]propyl]-4-oxo-3-phenylquinazolin-5-yl]benzoate |
|---|---|
| PubChem CID | 146633849 |
| Molecular Formula | C36H35N7O4 |
| Molecular Weight | 629.72 g/mol |
| Exact Mass | 629.28 |
| IUPAC Name | ethyl 4-[2-[(1S)-1-[[9-(oxan-2-yl)purin-6-yl]amino]propyl]-4-oxo-3-phenylquinazolin-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2cccc3nc([C@H](CC)Nc4ncnc5c4ncn5C4CCCCO4)n(-c4ccccc4)c(=O)c23)cc1 |
| InChI | InChI=1S/C36H35N7O4/c1-3-27(40-32-31-34(38-21-37-32)42(22-39-31)29-15-8-9-20-47-29)33-41-28-14-10-13-26(23-16-18-24(19-17-23)36(45)46-4-2)30(28)35(44)43(33)25-11-6-5-7-12-25/h5-7,10-14,16-19,21-22,27,29H,3-4,8-9,15,20H2,1-2H3,(H,37,38,40)/t27-,29?/m0/s1 |
| InChIKey | YUAMSOLGEWAKNL-BVOOQYFDSA-N |
| XLogP | 6.63 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.72 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |