About tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate
tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate (PubChem CID 146633929) has the molecular formula C16H21F2NO3
and a molecular weight of 313.34 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate |
| PubChem CID | 146633929 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate |
| SMILES | C[C@@H](CCC(=O)c1ccc(F)cc1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21F2NO3/c1-10(19-15(21)22-16(2,3)4)5-8-14(20)12-7-6-11(17)9-13(12)18/h6-7,9-10H,5,8H2,1-4H3,(H,19,21)/t10-/m0/s1 |
| InChIKey | PJJXLCMKOKUKKH-JTQLQIEISA-N |
| XLogP | 3.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate (CID 146633929) is tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate is C[C@@H](CCC(=O)c1ccc(F)cc1F)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate?
The InChIKey is PJJXLCMKOKUKKH-JTQLQIEISA-N. The full InChI is InChI=1S/C16H21F2NO3/c1-10(19-15(21)22-16(2,3)4)5-8-14(20)12-7-6-11(17)9-13(12)18/h6-7,9-10H,5,8H2,1-4H3,(H,19,21)/t10-/m0/s1.
What are the key properties of tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate?
tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate has a molecular weight of 313.34 g/mol, XLogP of 3.84, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S)-5-(2,4-difluorophenyl)-5-oxopentan-2-yl]carbamate is sourced from PubChem (CID 146633929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).