C20H32F3N — CID 146633931
(4Z)-N,12-dimethyl-6-methylidene-N-(1,1,1-trifluorobutan-2-yl)trideca-1,4,12-trien-2-amine (PubChem CID 146633931) has the molecular formula C20H32F3N and a molecular weight of 343.48 g/mol. Its IUPAC name is (4Z)-N,12-dimethyl-6-methylidene-N-(1,1,1-trifluorobutan-2-yl)trideca-1,4,12-trien-2-amine.
| Compound Name | (4Z)-N,12-dimethyl-6-methylidene-N-(1,1,1-trifluorobutan-2-yl)trideca-1,4,12-trien-2-amine |
|---|---|
| PubChem CID | 146633931 |
| Molecular Formula | C20H32F3N |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (4Z)-N,12-dimethyl-6-methylidene-N-(1,1,1-trifluorobutan-2-yl)trideca-1,4,12-trien-2-amine |
| SMILES | C=C(C)CCCCCC(=C)/C=C\CC(=C)N(C)C(CC)C(F)(F)F |
| InChI | InChI=1S/C20H32F3N/c1-7-19(20(21,22)23)24(6)18(5)15-11-14-17(4)13-10-8-9-12-16(2)3/h11,14,19H,2,4-5,7-10,12-13,15H2,1,3,6H3/b14-11- |
| InChIKey | BDNNMIATWNKYFZ-KAMYIIQDSA-N |
| XLogP | 6.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|