C38H35ClN4O6S2 — CID 146634340
methyl 1-(benzenesulfonyl)-2-[2-(3-chloropropylsulfonylamino)phenyl]-7-(dibenzylamino)pyrrolo[2,3-c]pyridine-4-carboxylate (PubChem CID 146634340) has the molecular formula C38H35ClN4O6S2 and a molecular weight of 743.31 g/mol. Its IUPAC name is methyl 1-(benzenesulfonyl)-2-[2-(3-chloropropylsulfonylamino)phenyl]-7-(dibenzylamino)pyrrolo[2,3-c]pyridine-4-carboxylate.
| Compound Name | methyl 1-(benzenesulfonyl)-2-[2-(3-chloropropylsulfonylamino)phenyl]-7-(dibenzylamino)pyrrolo[2,3-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 146634340 |
| Molecular Formula | C38H35ClN4O6S2 |
| Molecular Weight | 743.31 g/mol |
| Exact Mass | 742.17 |
| IUPAC Name | methyl 1-(benzenesulfonyl)-2-[2-(3-chloropropylsulfonylamino)phenyl]-7-(dibenzylamino)pyrrolo[2,3-c]pyridine-4-carboxylate |
| SMILES | COC(=O)c1cnc(N(Cc2ccccc2)Cc2ccccc2)c2c1cc(-c1ccccc1NS(=O)(=O)CCCCl)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C38H35ClN4O6S2/c1-49-38(44)33-25-40-37(42(26-28-14-5-2-6-15-28)27-29-16-7-3-8-17-29)36-32(33)24-35(43(36)51(47,48)30-18-9-4-10-19-30)31-20-11-12-21-34(31)41-50(45,46)23-13-22-39/h2-12,14-21,24-25,41H,13,22-23,26-27H2,1H3 |
| InChIKey | JSCNTZLEZPEVPP-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.31 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|