C25H28F3N7O — CID 146634528
4-(methylaminomethyl)-6-(1-methylcyclopropyl)-2-[6-[4-(1,1,1-trifluoropentan-3-yl)-1,2,4-triazol-3-yl]-2-pyridinyl]-3H-pyrrolo[3,4-c]pyridin-1-one (PubChem CID 146634528) has the molecular formula C25H28F3N7O and a molecular weight of 499.54 g/mol. Its IUPAC name is 4-(methylaminomethyl)-6-(1-methylcyclopropyl)-2-[6-[4-(1,1,1-trifluoropentan-3-yl)-1,2,4-triazol-3-yl]-2-pyridinyl]-3H-pyrrolo[3,4-c]pyridin-1-one.
| Compound Name | 4-(methylaminomethyl)-6-(1-methylcyclopropyl)-2-[6-[4-(1,1,1-trifluoropentan-3-yl)-1,2,4-triazol-3-yl]-2-pyridinyl]-3H-pyrrolo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 146634528 |
| Molecular Formula | C25H28F3N7O |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 4-(methylaminomethyl)-6-(1-methylcyclopropyl)-2-[6-[4-(1,1,1-trifluoropentan-3-yl)-1,2,4-triazol-3-yl]-2-pyridinyl]-3H-pyrrolo[3,4-c]pyridin-1-one |
| SMILES | CCC(CC(F)(F)F)n1cnnc1-c1cccc(N2Cc3c(cc(C4(C)CC4)nc3CNC)C2=O)n1 |
| InChI | InChI=1S/C25H28F3N7O/c1-4-15(11-25(26,27)28)35-14-30-33-22(35)18-6-5-7-21(32-18)34-13-17-16(23(34)36)10-20(24(2)8-9-24)31-19(17)12-29-3/h5-7,10,14-15,29H,4,8-9,11-13H2,1-3H3 |
| InChIKey | JPAHUZMLRDQURM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |