About ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate
ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 146634693) has the molecular formula C20H28N2O4S
and a molecular weight of 392.52 g/mol. Its IUPAC name is ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
Molecular Properties
| Compound Name | ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| PubChem CID | 146634693 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC1)C/C(=N\[S@@](=O)C(C)(C)C)c1ccccc1O2 |
| InChI | InChI=1S/C20H28N2O4S/c1-5-25-18(23)22-12-10-20(11-13-22)14-16(21-27(24)19(2,3)4)15-8-6-7-9-17(15)26-20/h6-9H,5,10-14H2,1-4H3/b21-16+/t27-/m0/s1 |
| InChIKey | ACDIACDILSTSTK-BHAFLUAZSA-N |
| XLogP | 3.71 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The IUPAC name of ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (CID 146634693) is ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
What is the SMILES notation for ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The canonical SMILES for ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate is CCOC(=O)N1CCC2(CC1)C/C(=N\[S@@](=O)C(C)(C)C)c1ccccc1O2.
What is the InChIKey of ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The InChIKey is ACDIACDILSTSTK-BHAFLUAZSA-N. The full InChI is InChI=1S/C20H28N2O4S/c1-5-25-18(23)22-12-10-20(11-13-22)14-16(21-27(24)19(2,3)4)15-8-6-7-9-17(15)26-20/h6-9H,5,10-14H2,1-4H3/b21-16+/t27-/m0/s1.
What are the key properties of ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate has a molecular weight of 392.52 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate is sourced from PubChem (CID 146634693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).