C20H28N2O4S — CID 146634693
ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 146634693) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 146634693 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | ethyl (4E)-4-[(S)-tert-butylsulfinyl]iminospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC1)C/C(=N\[S@@](=O)C(C)(C)C)c1ccccc1O2 |
| InChI | InChI=1S/C20H28N2O4S/c1-5-25-18(23)22-12-10-20(11-13-22)14-16(21-27(24)19(2,3)4)15-8-6-7-9-17(15)26-20/h6-9H,5,10-14H2,1-4H3/b21-16+/t27-/m0/s1 |
| InChIKey | ACDIACDILSTSTK-BHAFLUAZSA-N |
| XLogP | 3.71 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|