About N-butan-2-yl-1,1,1-trifluoromethanesulfonamide
N-butan-2-yl-1,1,1-trifluoromethanesulfonamide (PubChem CID 14663477) has the molecular formula C5H10F3NO2S
and a molecular weight of 205.20 g/mol. Its IUPAC name is N-butan-2-yl-1,1,1-trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | N-butan-2-yl-1,1,1-trifluoromethanesulfonamide |
| PubChem CID | 14663477 |
| Molecular Formula | C5H10F3NO2S |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | N-butan-2-yl-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCC(C)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H10F3NO2S/c1-3-4(2)9-12(10,11)5(6,7)8/h4,9H,3H2,1-2H3 |
| InChIKey | ZZFBAWJISLFGSN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butan-2-yl-1,1,1-trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-1,1,1-trifluoromethanesulfonamide?
The IUPAC name of N-butan-2-yl-1,1,1-trifluoromethanesulfonamide (CID 14663477) is N-butan-2-yl-1,1,1-trifluoromethanesulfonamide.
What is the SMILES notation for N-butan-2-yl-1,1,1-trifluoromethanesulfonamide?
The canonical SMILES for N-butan-2-yl-1,1,1-trifluoromethanesulfonamide is CCC(C)NS(=O)(=O)C(F)(F)F.
What is the InChIKey of N-butan-2-yl-1,1,1-trifluoromethanesulfonamide?
The InChIKey is ZZFBAWJISLFGSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10F3NO2S/c1-3-4(2)9-12(10,11)5(6,7)8/h4,9H,3H2,1-2H3.
What are the key properties of N-butan-2-yl-1,1,1-trifluoromethanesulfonamide?
N-butan-2-yl-1,1,1-trifluoromethanesulfonamide has a molecular weight of 205.20 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-1,1,1-trifluoromethanesulfonamide is sourced from PubChem (CID 14663477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).