About ethenyl N-ethenyl-2-methylpentanimidothioate
ethenyl N-ethenyl-2-methylpentanimidothioate (PubChem CID 146634872) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is ethenyl N-ethenyl-2-methylpentanimidothioate.
Molecular Properties
| Compound Name | ethenyl N-ethenyl-2-methylpentanimidothioate |
| PubChem CID | 146634872 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | ethenyl N-ethenyl-2-methylpentanimidothioate |
| SMILES | C=C/N=C(\SC=C)C(C)CCC |
| InChI | InChI=1S/C10H17NS/c1-5-8-9(4)10(11-6-2)12-7-3/h6-7,9H,2-3,5,8H2,1,4H3/b11-10- |
| InChIKey | FMRYSPORJMEUKW-KHPPLWFESA-N |
| XLogP | 3.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethenyl N-ethenyl-2-methylpentanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl N-ethenyl-2-methylpentanimidothioate?
The IUPAC name of ethenyl N-ethenyl-2-methylpentanimidothioate (CID 146634872) is ethenyl N-ethenyl-2-methylpentanimidothioate.
What is the SMILES notation for ethenyl N-ethenyl-2-methylpentanimidothioate?
The canonical SMILES for ethenyl N-ethenyl-2-methylpentanimidothioate is C=C/N=C(\SC=C)C(C)CCC.
What is the InChIKey of ethenyl N-ethenyl-2-methylpentanimidothioate?
The InChIKey is FMRYSPORJMEUKW-KHPPLWFESA-N. The full InChI is InChI=1S/C10H17NS/c1-5-8-9(4)10(11-6-2)12-7-3/h6-7,9H,2-3,5,8H2,1,4H3/b11-10-.
What are the key properties of ethenyl N-ethenyl-2-methylpentanimidothioate?
ethenyl N-ethenyl-2-methylpentanimidothioate has a molecular weight of 183.32 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl N-ethenyl-2-methylpentanimidothioate is sourced from PubChem (CID 146634872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).