About 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile
3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile (PubChem CID 14663554) has the molecular formula C6H6N2O3
and a molecular weight of 154.12 g/mol. Its IUPAC name is 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile.
Molecular Properties
| Compound Name | 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile |
| PubChem CID | 14663554 |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile |
| SMILES | N#CCCC1(C#N)OCOO1 |
| InChI | InChI=1S/C6H6N2O3/c7-3-1-2-6(4-8)9-5-10-11-6/h1-2,5H2 |
| InChIKey | OHPZWSQVFQMSCY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile?
The IUPAC name of 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile (CID 14663554) is 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile.
What is the SMILES notation for 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile?
The canonical SMILES for 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile is N#CCCC1(C#N)OCOO1.
What is the InChIKey of 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile?
The InChIKey is OHPZWSQVFQMSCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O3/c7-3-1-2-6(4-8)9-5-10-11-6/h1-2,5H2.
What are the key properties of 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile?
3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile has a molecular weight of 154.12 g/mol, XLogP of 0.45, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-cyanoethyl)-1,2,4-trioxolane-3-carbonitrile is sourced from PubChem (CID 14663554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).