C21H23ClF3N3O3 — CID 146635634
1-[1-[(3aS,6aR)-5-[[3-chloro-2-(trifluoromethyl)phenyl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethyl]pyrazole-3-carboxylic acid (PubChem CID 146635634) has the molecular formula C21H23ClF3N3O3 and a molecular weight of 457.88 g/mol. Its IUPAC name is 1-[1-[(3aS,6aR)-5-[[3-chloro-2-(trifluoromethyl)phenyl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[1-[(3aS,6aR)-5-[[3-chloro-2-(trifluoromethyl)phenyl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 146635634 |
| Molecular Formula | C21H23ClF3N3O3 |
| Molecular Weight | 457.88 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 1-[1-[(3aS,6aR)-5-[[3-chloro-2-(trifluoromethyl)phenyl]methoxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]ethyl]pyrazole-3-carboxylic acid |
| SMILES | CC(N1C[C@H]2CC(OCc3cccc(Cl)c3C(F)(F)F)C[C@H]2C1)n1ccc(C(=O)O)n1 |
| InChI | InChI=1S/C21H23ClF3N3O3/c1-12(28-6-5-18(26-28)20(29)30)27-9-14-7-16(8-15(14)10-27)31-11-13-3-2-4-17(22)19(13)21(23,24)25/h2-6,12,14-16H,7-11H2,1H3,(H,29,30)/t12?,14-,15+,16? |
| InChIKey | XKSRAYDUIGVZCW-PYCGDYPRSA-N |
| XLogP | 4.70 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.88 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |